Products 1323966-18-2

CAS 1323966-18-2 is the registry number for 2-Fluoro-5-methyl-4-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-methyl-4-(trifluoromethyl)benzoyl chloride (CAS 1323966-18-2) is a chemical compound with the molecular formula C9H5ClF4O and a molecular weight of 240.58 g/mol. IUPAC name: 2-fluoro-5-methyl-4-(trifluoromethyl)benzoyl chloride. InChIKey: UDEWPGOZXPREEI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClF4O
Molecular weight240.58 g/mol
IUPAC name2-fluoro-5-methyl-4-(trifluoromethyl)benzoyl chloride
InChIKeyUDEWPGOZXPREEI-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(F)(F)F)F)C(=O)Cl

Computed by PubChem (NCBI)