Products 1373920-95-6

CAS 1373920-95-6 appears in our catalog under these names: 4-Fluoro-3-methyl-5-(trifluoromethyl)benzoyl chloride, 95%, 4-Fluoro-3-Methyl-5-(trifluoromethyl)benzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-3-methyl-5-(trifluoromethyl)benzoyl chloride (CAS 1373920-95-6) is a chemical compound with the molecular formula C9H5ClF4O and a molecular weight of 240.58 g/mol. IUPAC name: 4-fluoro-3-methyl-5-(trifluoromethyl)benzoyl chloride. InChIKey: CVJZTMWMSKRYDY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClF4O
Molecular weight240.58 g/mol
IUPAC name4-fluoro-3-methyl-5-(trifluoromethyl)benzoyl chloride
InChIKeyCVJZTMWMSKRYDY-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)