CAS 2807441-20-7 is the registry number for 1-(2-Chloro-5-fluoro-3-methylphenyl)-2,2,2-trifluoroethan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-chloro-5-fluoro-3-methylphenyl)-2,2,2-trifluoroethanone (CAS 2807441-20-7) is a chemical compound with the molecular formula C9H5ClF4O and a molecular weight of 240.58 g/mol. IUPAC name: 1-(2-chloro-5-fluoro-3-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: OTUVAXHEFUYWLL-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF4O |
|---|---|
| Molecular weight | 240.58 g/mol |
| IUPAC name | 1-(2-chloro-5-fluoro-3-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | OTUVAXHEFUYWLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Cl)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)