cas: 199296-61-2 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethyl)benzylamine, 98%+(GC-MS),RG, 98%+(GC-MS),RG (CAS 199296-61-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113C2C-1g |
| cas | 199296-61-2 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1725.20 Pln | |
| Chemat | 100g | 6606.80 Pln |
| purity | 98%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
[2-fluoro-5-(trifluoromethyl)phenyl]methanamine (CAS 199296-61-2) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethyl)phenyl]methanamine. InChIKey: WIQWADYBGSRGCF-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethyl)phenyl]methanamine |
| InChIKey | WIQWADYBGSRGCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CN)F |
Computed by PubChem (NCBI)