cas: 199296-61-2 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethyl)benzylamine (CAS 199296-61-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006417-1G |
| cas | 199296-61-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 700.81 Pln | |
| Fluorochem | 25g | 2830.27 Pln | |
| Fluorochem | 100g | 10671.26 Pln |
| delivery time | 2-3 weeks |
|---|
[2-fluoro-5-(trifluoromethyl)phenyl]methanamine (CAS 199296-61-2) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: [2-fluoro-5-(trifluoromethyl)phenyl]methanamine. InChIKey: WIQWADYBGSRGCF-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | [2-fluoro-5-(trifluoromethyl)phenyl]methanamine |
| InChIKey | WIQWADYBGSRGCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CN)F |
Computed by PubChem (NCBI)