cas: 1214334-01-6 — see every product listed under this CAS number, including other names
2-Fluoro-5-methoxybenzene-1-sulfonyl chloride, 95%, 95% (CAS 1214334-01-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125SY-250mg |
| cas | 1214334-01-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 5g | 1941.20 Pln | |
| Chemat | 10g | 3496.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-5-methoxybenzenesulfonyl chloride (CAS 1214334-01-6) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 2-fluoro-5-methoxybenzenesulfonyl chloride. InChIKey: MEOZOFVLIUUROW-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 2-fluoro-5-methoxybenzenesulfonyl chloride |
| InChIKey | MEOZOFVLIUUROW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)