cas: 369-36-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-nitroaniline, 98% (CAS 369-36-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 10g, 1g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 168390050 |
| cas | 369-36-8 |
| size | 5g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 97.55 Pln | |
| Thermo Scientific (Acros) | 25g | 260.59 Pln | |
| Thermo Scientific (Acros) | 100g | 792.89 Pln | |
| Sigma-Aldrich | 25G | 379.00 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 117.68 Pln | |
| Fluorochem | 100g | 268.67 Pln | |
| Fluorochem | 500g | 1049.65 Pln | |
| Fluorochem | 1kg | 2007.64 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
2-fluoro-5-nitroaniline (CAS 369-36-8) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-5-nitroaniline. InChIKey: KJVBJICWGQIMOZ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-5-nitroaniline |
| InChIKey | KJVBJICWGQIMOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)F |
Computed by PubChem (NCBI)