cas: 842136-58-7 — see every product listed under this CAS number, including other names
2-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 842136-58-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216208-250MG |
| cas | 842136-58-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 7823.30 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 842136-58-7) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: WGPVNHXZZUGSMO-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | WGPVNHXZZUGSMO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)F |
Computed by PubChem (NCBI)