CAS 458532-86-0 appears in our catalog under these names: 2–Fluoropyridine–4–boronic acid pinacol ester, 2-Fluoropyridine-4-boronic acid pinacol ester, 95% , 2-Fluoropyridine-4-boronic acid pinacol ester, 95%, 2-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g, 100g, 500g.
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 458532-86-0) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PCLMNCBIXQQRMB-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PCLMNCBIXQQRMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)F |
Computed by PubChem (NCBI)