Products 1334173-41-9
CAS 1334173-41-9 appears in our catalog under these names: 2-fluoro-5-(pyrrolidin-1-ylmethyl)phenylboronic acid, 95%, (2–Fluoro–5–(pyrrolidin–1–ylmethyl)phenyl)boronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g.
[2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1334173-41-9) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: [2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: HLWMXKJWFMWNGE-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | [2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | HLWMXKJWFMWNGE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CN2CCCC2)F)(O)O |
Computed by PubChem (NCBI)