CAS 1704063-89-7 appears in our catalog under these names: 4-Fluoro-3-(pyrrolidin-1-ylmethyl)phenylboronic acid, 95%, 4–Fluoro–3–(pyrrolidin–1–ylmethyl)phenylboronic acid, 4-Fluoro-3-(pyrrolidin-1-ylmethyl)phenylboronic acid. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
[4-fluoro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1704063-89-7) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: [4-fluoro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: UHZIRXVQTSPFCW-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | [4-fluoro-3-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | UHZIRXVQTSPFCW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CN2CCCC2)(O)O |
Computed by PubChem (NCBI)