cas: 2085307-54-4 — see every product listed under this CAS number, including other names
2-Fluoro-6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 2085307-54-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13342R-100mg |
| cas | 2085307-54-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 5g | 4907.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2085307-54-4) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: 2-fluoro-6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: SSKNRUNOVYHKCO-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2-fluoro-6-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | SSKNRUNOVYHKCO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)OC)F |
Computed by PubChem (NCBI)