Products 1314143-65-1
CAS 1314143-65-1 is the registry number for (3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)methanol, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanol (CAS 1314143-65-1) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanol. InChIKey: ZQSOOIJIDNUIDI-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanol |
| InChIKey | ZQSOOIJIDNUIDI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)CO)F |
Computed by PubChem (NCBI)