Products 1704063-91-1
CAS 1704063-91-1 is the registry number for 4–Fluoro–3–((4–hydroxypiperidin–1–yl)methyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-fluoro-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]boronic acid (CAS 1704063-91-1) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: [4-fluoro-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: ONCNDEAZJHXFLM-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | [4-fluoro-3-[(4-hydroxypiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | ONCNDEAZJHXFLM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CN2CCC(CC2)O)(O)O |
Computed by PubChem (NCBI)