CAS 2819705-97-8 is the registry number for 2-Fluoro-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2819705-97-8) is a chemical compound with the molecular formula C12H17BFNO3 and a molecular weight of 253.08 g/mol. IUPAC name: 2-fluoro-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YXYUOWPPKCAPAF-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO3 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2-fluoro-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YXYUOWPPKCAPAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2OC)F |
Computed by PubChem (NCBI)