cas: 19346-45-3 — see every product listed under this CAS number, including other names
2-Fluoro-6-methyl-3-nitropyridine 97% (CAS 19346-45-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195251-250mg |
| cas | 19346-45-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 387.06 Pln | |
| Ambeed | 25g | 865.44 Pln | |
| Ambeed | 100g | 3251.75 Pln | |
| Ambeed | 500g | 14465.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A195251 |
2-fluoro-6-methyl-3-nitropyridine (CAS 19346-45-3) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-6-methyl-3-nitropyridine. InChIKey: BCCWOQXQVNCXKC-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-6-methyl-3-nitropyridine |
| InChIKey | BCCWOQXQVNCXKC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)