cas: 1042986-01-5 — see every product listed under this CAS number, including other names
2-Fluoro-N-methoxy-N,5-dimethylnicotinamide (CAS 1042986-01-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629964-1G |
| cas | 1042986-01-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 5386.66 Pln | |
| Fluorochem | 5g | 16028.75 Pln |
| delivery time | 3-4 weeks |
|---|
2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide (CAS 1042986-01-5) is a chemical compound with the molecular formula C9H11FN2O2 and a molecular weight of 198.19 g/mol. IUPAC name: 2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide. InChIKey: SKKGTLZGDNPWSS-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide |
| InChIKey | SKKGTLZGDNPWSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)F)C(=O)N(C)OC |
Computed by PubChem (NCBI)