CAS 210697-20-4 is the registry number for Methyl 6-(dimethylamino)-2-fluoronicotinate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg.
Methyl 6-(dimethylamino)-2-fluoropyridine-3-carboxylate (CAS 210697-20-4) is a chemical compound with the molecular formula C9H11FN2O2 and a molecular weight of 198.19 g/mol. IUPAC name: methyl 6-(dimethylamino)-2-fluoropyridine-3-carboxylate. InChIKey: DDRVSQDSMWRGAB-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | methyl 6-(dimethylamino)-2-fluoropyridine-3-carboxylate |
| InChIKey | DDRVSQDSMWRGAB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=C(C=C1)C(=O)OC)F |
Computed by PubChem (NCBI)