CAS 951667-98-4 appears in our catalog under these names: 5-Fluoro-2-nitro-N-propylaniline, 96%, 5-Fluoro-2-nitro-N-propylaniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g.
5-fluoro-2-nitro-N-propylaniline (CAS 951667-98-4) is a chemical compound with the molecular formula C9H11FN2O2 and a molecular weight of 198.19 g/mol. IUPAC name: 5-fluoro-2-nitro-N-propylaniline. InChIKey: YDBGMWGWMVRJRH-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 5-fluoro-2-nitro-N-propylaniline |
| InChIKey | YDBGMWGWMVRJRH-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)