Products 1042986-01-5
CAS 1042986-01-5 appears in our catalog under these names: 2-Fluoro-N-methoxy-N,5-dimethylnicotinamide, 2-Fluoro-n-methoxy-n,5-dimethylnicotinamide, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 25g, 10g, 250mg.
2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide (CAS 1042986-01-5) is a chemical compound with the molecular formula C9H11FN2O2 and a molecular weight of 198.19 g/mol. IUPAC name: 2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide. InChIKey: SKKGTLZGDNPWSS-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O2 |
|---|---|
| Molecular weight | 198.19 g/mol |
| IUPAC name | 2-fluoro-N-methoxy-N,5-dimethylpyridine-3-carboxamide |
| InChIKey | SKKGTLZGDNPWSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)F)C(=O)N(C)OC |
Computed by PubChem (NCBI)