cas: 2377607-34-4 — see every product listed under this CAS number, including other names
2-Fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 97% (CAS 2377607-34-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A115941-250mg |
| cas | 2377607-34-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A115941 |
2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2377607-34-4) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: 2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: OMRDOYPHMSWHKI-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-fluoro-N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | OMRDOYPHMSWHKI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(=O)NC)F |
Computed by PubChem (NCBI)