CAS 1150271-55-8 appears in our catalog under these names: 2-Acetamido-5-fluorophenylboronic acid, pinacol ester, 98%, 2-Acetamido-5-fluorophenylboronic Acid Pinacol Ester, N-(4-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg, 25g.
N-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1150271-55-8) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: N-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: QDEPNKWUQUKTAM-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | N-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | QDEPNKWUQUKTAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)NC(=O)C |
Computed by PubChem (NCBI)