CAS 2377611-28-2 is the registry number for 5-Fluoro-n-methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-fluoro-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2377611-28-2) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: 5-fluoro-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: LBJVDJCYWACAOF-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 5-fluoro-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | LBJVDJCYWACAOF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)C(=O)NC |
Computed by PubChem (NCBI)