CAS 1150271-67-2 appears in our catalog under these names: N-(5-Fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 95%, 2-Acetamido-4-fluorophenylboronic Acid Pinacol Ester, 2-Acetamido-4-fluorophenylboronic acid, pinacol ester, 95%. Offered by: AmBeed, TRC, Combi-blocks. Available pack sizes: 10g, 250mg, 5g, 1g.
N-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1150271-67-2) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: N-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: PRDXPRJIXNWRSJ-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | N-[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | PRDXPRJIXNWRSJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)NC(=O)C |
Computed by PubChem (NCBI)