cas: 2222333-26-6 — see every product listed under this CAS number, including other names
2-Fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 95% (CAS 2222333-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741564-100mg |
| cas | 2222333-26-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A741564 |
2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2222333-26-6) is a chemical compound with the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. IUPAC name: 2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XJUQXWHNVGTSOI-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | 2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XJUQXWHNVGTSOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C(=O)NC |
Computed by PubChem (NCBI)