cas: 342-24-5 — see every product listed under this CAS number, including other names
2-Fluorobenzophenone, 98%, 98% (CAS 342-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HBK-100g |
| cas | 342-24-5 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 410.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-fluorophenyl)-phenylmethanone (CAS 342-24-5) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: (2-fluorophenyl)-phenylmethanone. InChIKey: DWFDQVMFSLLMPE-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | (2-fluorophenyl)-phenylmethanone |
| InChIKey | DWFDQVMFSLLMPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2F |
Computed by PubChem (NCBI)