cas: 389-31-1 — see every product listed under this CAS number, including other names
2-Fluoromandelic acid, 97% (CAS 389-31-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009726-5G |
| cas | 389-31-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 414.45 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 25g | 950.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 389-31-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)F |
Computed by PubChem (NCBI)