cas: 52356-01-1 — see every product listed under this CAS number, including other names
2-Hydrazinylbenzoic acid hydrochloride, 95%, 95% (CAS 52356-01-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144C3-1g |
| cas | 52356-01-1 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 597.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-hydrazinylbenzoic acid;hydrochloride (CAS 52356-01-1) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 2-hydrazinylbenzoic acid;hydrochloride. InChIKey: ZGNNOFKURIXXRF-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 2-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | ZGNNOFKURIXXRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NN.Cl |
Computed by PubChem (NCBI)