CAS 87565-98-8 appears in our catalog under these names: 3-Hydrazinobenzoic Acid Hydrochloride, 98%, 98%, 3-Hydrazinylbenzoic acid hydrochloride, 97%, 3–Hydrazinobenzoic Acid Hydrochloride, 3-Hydrazinobenzoic acid hydrochloride, 95%. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g.
3-hydrazinylbenzoic acid;hydrochloride (CAS 87565-98-8) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 3-hydrazinylbenzoic acid;hydrochloride. InChIKey: YONFQPJFIKYVLO-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 3-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | YONFQPJFIKYVLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN)C(=O)O.Cl |
Computed by PubChem (NCBI)