CAS 2225143-91-7 appears in our catalog under these names: 2,6-dimethylpyrimidine-4-carboxylic acid hydrochloride, 95%, 2,6-Dimethylpyrimidine-4-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2,6-dimethylpyrimidine-4-carboxylic acid;hydrochloride (CAS 2225143-91-7) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 2,6-dimethylpyrimidine-4-carboxylic acid;hydrochloride. InChIKey: GGRHZIJNYDYCIT-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 2,6-dimethylpyrimidine-4-carboxylic acid;hydrochloride |
| InChIKey | GGRHZIJNYDYCIT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)