Products 1247448-08-3

CAS 1247448-08-3 is the registry number for 4-Chloro-5-ethyl-1-methyl-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-chloro-5-ethyl-1-methylpyrazole-3-carboxylic acid (CAS 1247448-08-3) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 4-chloro-5-ethyl-1-methylpyrazole-3-carboxylic acid. InChIKey: LCRPCRXRYZHZKK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9ClN2O2
Molecular weight188.61 g/mol
IUPAC name4-chloro-5-ethyl-1-methylpyrazole-3-carboxylic acid
InChIKeyLCRPCRXRYZHZKK-UHFFFAOYSA-N
SMILESCCC1=C(C(=NN1C)C(=O)O)Cl

Computed by PubChem (NCBI)