cas: 15793-77-8 — see every product listed under this CAS number, including other names
2-Hydrazinylquinoline 98% (CAS 15793-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A562757-100mg |
| cas | 15793-77-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 481.62 Pln | |
| Ambeed | 25g | 1961.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A562757 |
Quinolin-2-ylhydrazine (CAS 15793-77-8) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: quinolin-2-ylhydrazine. InChIKey: QMVCLSHKMIGEFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | quinolin-2-ylhydrazine |
| InChIKey | QMVCLSHKMIGEFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)NN |
Computed by PubChem (NCBI)