cas: 5274-70-4 — see every product listed under this CAS number, including other names
2-Hydroxy-3-nitrobenzaldehyde 98% (CAS 5274-70-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A724102-1g |
| cas | 5274-70-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 954.44 Pln | |
| Ambeed | 10g | 1744.31 Pln | |
| Ambeed | 25g | 4191.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A724102 |
2-hydroxy-3-nitrobenzaldehyde (CAS 5274-70-4) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 2-hydroxy-3-nitrobenzaldehyde. InChIKey: NUGOTBXFVWXVTE-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | NUGOTBXFVWXVTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)