cas: 5274-70-4 — see every product listed under this CAS number, including other names
3-Nitrosalicylaldehyde, >98.0%(GC)(T) (CAS 5274-70-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0823-1G |
| cas | 5274-70-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 413.38 Pln | |
| TCI | 5g | 1411.58 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-hydroxy-3-nitrobenzaldehyde (CAS 5274-70-4) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 2-hydroxy-3-nitrobenzaldehyde. InChIKey: NUGOTBXFVWXVTE-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | NUGOTBXFVWXVTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)