cas: 5274-70-4 — see every product listed under this CAS number, including other names
2-Hydroxy-3-nitrobenzaldehyde, 99.80% (CAS 5274-70-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 mg, 250 mg, 25 g, 1 g, 500 mg, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Z0547-5 g |
| cas | 5274-70-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1740.76 Pln | |
| MedChemExpress | 100 mg | 254.68 Pln | |
| MedChemExpress | 250 mg | 384.71 Pln | |
| MedChemExpress | 25 g | 5302.70 Pln | |
| MedChemExpress | 1 g | 765.52 Pln | |
| MedChemExpress | 500 mg | 528.67 Pln | |
| MedChemExpress | 10 g | 2711.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.80% |
2-hydroxy-3-nitrobenzaldehyde (CAS 5274-70-4) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 2-hydroxy-3-nitrobenzaldehyde. InChIKey: NUGOTBXFVWXVTE-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | NUGOTBXFVWXVTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)