cas: 24667-09-2 — see every product listed under this CAS number, including other names
2-Hydroxy-4,6-dimethylnicotinic acid (CAS 24667-09-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F316317-100MG |
| cas | 24667-09-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 440.49 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 966.34 Pln |
| delivery time | 3-4 weeks |
|---|
4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 24667-09-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: IBXQMVFDHWEASI-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | IBXQMVFDHWEASI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)O)C |
Computed by PubChem (NCBI)