cas: 24667-09-2 — see every product listed under this CAS number, including other names
4,6-Dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 97%, 97% (CAS 24667-09-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113OZT-1g |
| cas | 24667-09-2 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 597.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 24667-09-2) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: IBXQMVFDHWEASI-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4,6-dimethyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | IBXQMVFDHWEASI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)C(=O)O)C |
Computed by PubChem (NCBI)