cas: 163451-82-9 — see every product listed under this CAS number, including other names
2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid, 97%, 97% (CAS 163451-82-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYVK-10g |
| cas | 163451-82-9 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 856.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 602.00 Pln | |
| Chemat | 25g | 1523.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-4-(2-hydroxyethoxy)benzoic acid (CAS 163451-82-9) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-hydroxy-4-(2-hydroxyethoxy)benzoic acid. InChIKey: INEIMLMPQGJCGK-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-hydroxy-4-(2-hydroxyethoxy)benzoic acid |
| InChIKey | INEIMLMPQGJCGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCCO)O)C(=O)O |
Computed by PubChem (NCBI)