Products 1023814-92-7
CAS 1023814-92-7 is the registry number for 6-Oxospiro[3.3]heptane-2,2-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-oxospiro[3.3]heptane-2,2-dicarboxylic acid (CAS 1023814-92-7) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 6-oxospiro[3.3]heptane-2,2-dicarboxylic acid. InChIKey: DQCDFXIUPJNZGB-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 6-oxospiro[3.3]heptane-2,2-dicarboxylic acid |
| InChIKey | DQCDFXIUPJNZGB-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC12CC(C2)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)