CAS 5722-93-0 appears in our catalog under these names: 2-Hydroxy-4,5-dimethoxybenzoic acid, 97%, Acotiamide Impurity 42, 4,5-Dimethoxysalicylic Acid, 2–Hydroxy–4,5–Dimethoxy Benzoic Acid, 2-HYDROXY-4,5-DIMETHOXY BENZOIC ACID, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 10g, 1g, on request, 2,5g, 0,25g, 250mg.
2-hydroxy-4,5-dimethoxybenzoic acid (CAS 5722-93-0) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-hydroxy-4,5-dimethoxybenzoic acid. InChIKey: RUBXSZYVSFYJQR-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-hydroxy-4,5-dimethoxybenzoic acid |
| InChIKey | RUBXSZYVSFYJQR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)O)OC |
Computed by PubChem (NCBI)