Products 1038374-86-5

CAS 1038374-86-5 is the registry number for 2-Hydroxy-3-(2-hydroxyethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(2-hydroxyethoxy)benzoic acid (CAS 1038374-86-5) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-hydroxy-3-(2-hydroxyethoxy)benzoic acid. InChIKey: REOKCQWZJVFHKN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O5
Molecular weight198.17 g/mol
IUPAC name2-hydroxy-3-(2-hydroxyethoxy)benzoic acid
InChIKeyREOKCQWZJVFHKN-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)OCCO)O)C(=O)O

Computed by PubChem (NCBI)