cas: 58914-34-4 — see every product listed under this CAS number, including other names
2-Hydroxy-4-(trifluoromethyl)benzaldehyde 97% (CAS 58914-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A125526-100mg |
| cas | 58914-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1049.00 Pln | |
| Ambeed | 25g | 3007.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A125526 |
2-hydroxy-4-(trifluoromethyl)benzaldehyde (CAS 58914-34-4) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2-hydroxy-4-(trifluoromethyl)benzaldehyde. InChIKey: YHYNJGHMBMXAFB-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2-hydroxy-4-(trifluoromethyl)benzaldehyde |
| InChIKey | YHYNJGHMBMXAFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)C=O |
Computed by PubChem (NCBI)