cas: 27420-41-3 — see every product listed under this CAS number, including other names
2-Hydroxy-4H-pyrido(1,2-a)pyrimidin-4-one, 98% (CAS 27420-41-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A463755-10g |
| cas | 27420-41-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5147.80 Pln | |
| AmBeed | 250mg | 493.15 Pln | |
| AmBeed | 25g | 10225.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-hydroxypyrido[1,2-a]pyrimidin-4-one (CAS 27420-41-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-hydroxypyrido[1,2-a]pyrimidin-4-one. InChIKey: VVAVOWMMXLKTHN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-hydroxypyrido[1,2-a]pyrimidin-4-one |
| InChIKey | VVAVOWMMXLKTHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)O |
Computed by PubChem (NCBI)