cas: 27420-41-3 — see every product listed under this CAS number, including other names
4-hydroxy-2H-pyrido[1,2-a]pyrimidin-2-one, 97% (CAS 27420-41-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604230-250MG |
| cas | 27420-41-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-hydroxypyrido[1,2-a]pyrimidin-4-one (CAS 27420-41-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-hydroxypyrido[1,2-a]pyrimidin-4-one. InChIKey: VVAVOWMMXLKTHN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-hydroxypyrido[1,2-a]pyrimidin-4-one |
| InChIKey | VVAVOWMMXLKTHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CC(=O)N2C=C1)O |
Computed by PubChem (NCBI)