cas: 1245569-58-7 — see every product listed under this CAS number, including other names
2-Hydroxy-5-methyl-4-oxo-3,4-dihydropyrido(2,3-d)pyrimidine-7-carboxylic acid, 98% (CAS 1245569-58-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A569515-10g |
| cas | 1245569-58-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid (CAS 1245569-58-7) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid. InChIKey: QWFSZGNCFXZWPF-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid |
| InChIKey | QWFSZGNCFXZWPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=O)NC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)