cas: 1245569-58-7 — see every product listed under this CAS number, including other names
2-hydroxy-5-methyl-4-oxo-3H,4H-pyrido[2,3-d]pyrimidine-7-carboxylic acid (CAS 1245569-58-7) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EKBM-5mg |
| cas | 1245569-58-7 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid (CAS 1245569-58-7) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: 5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid. InChIKey: QWFSZGNCFXZWPF-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 5-methyl-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-7-carboxylic acid |
| InChIKey | QWFSZGNCFXZWPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=O)NC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)