Products 1100053-97-1
CAS 1100053-97-1 is the registry number for 2-Iodo-1-isopropyl-4-nitrobenzene, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-iodo-4-nitro-1-propan-2-ylbenzene (CAS 1100053-97-1) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: 2-iodo-4-nitro-1-propan-2-ylbenzene. InChIKey: JFOQZXKNSMZHNE-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | 2-iodo-4-nitro-1-propan-2-ylbenzene |
| InChIKey | JFOQZXKNSMZHNE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)