cas: 364-77-2 — see every product listed under this CAS number, including other names
2-Iodo-5-fluoronitrobenzene 99% (CAS 364-77-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1475846-5g |
| cas | 364-77-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 776.44 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1475846 |
4-fluoro-1-iodo-2-nitrobenzene (CAS 364-77-2) is a chemical compound with the molecular formula C6H3FINO2 and a molecular weight of 267.00 g/mol. IUPAC name: 4-fluoro-1-iodo-2-nitrobenzene. InChIKey: ANPFMDLUEWNKIM-UHFFFAOYSA-N.
| Molecular formula | C6H3FINO2 |
|---|---|
| Molecular weight | 267.00 g/mol |
| IUPAC name | 4-fluoro-1-iodo-2-nitrobenzene |
| InChIKey | ANPFMDLUEWNKIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])I |
Computed by PubChem (NCBI)