cas: 41252-98-6 — see every product listed under this CAS number, including other names
2-Iodo-6-nitrotoluene, 97% (CAS 41252-98-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035166-250MG |
| cas | 41252-98-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 315.53 Pln | |
| Fluorochem | 10g | 565.44 Pln | |
| Fluorochem | 25g | 1002.79 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-iodo-2-methyl-3-nitrobenzene (CAS 41252-98-6) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-2-methyl-3-nitrobenzene. InChIKey: ZVAKFJFOGUFJON-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-2-methyl-3-nitrobenzene |
| InChIKey | ZVAKFJFOGUFJON-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1I)[N+](=O)[O-] |
Computed by PubChem (NCBI)