CAS 123158-78-1 appears in our catalog under these names: 1-Iodo-3-methyl-5-nitrobenzene, 1-Iodo-3-methyl-5-nitrobenzene, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 1g, 250mg.
1-iodo-3-methyl-5-nitrobenzene (CAS 123158-78-1) is a chemical compound with the molecular formula C7H6INO2 and a molecular weight of 263.03 g/mol. IUPAC name: 1-iodo-3-methyl-5-nitrobenzene. InChIKey: VIGIBQJFOYFDSH-UHFFFAOYSA-N.
| Molecular formula | C7H6INO2 |
|---|---|
| Molecular weight | 263.03 g/mol |
| IUPAC name | 1-iodo-3-methyl-5-nitrobenzene |
| InChIKey | VIGIBQJFOYFDSH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)